C11H22N4O — CID 119113118
2,2-dimethyl-N-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethyl]propanamide (PubChem CID 119113118) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 119113118 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 2,2-dimethyl-N-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCNC1=NCCCN1 |
| InChI | InChI=1S/C11H22N4O/c1-11(2,3)9(16)12-7-8-15-10-13-5-4-6-14-10/h4-8H2,1-3H3,(H,12,16)(H2,13,14,15) |
| InChIKey | BEMVFCMIRHYEIV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|