About 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one
1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one (PubChem CID 58774108) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one |
| PubChem CID | 58774108 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one |
| SMILES | CC(C)C(=O)CCNC1=NCCN1 |
| InChI | InChI=1S/C9H17N3O/c1-7(2)8(13)3-4-10-9-11-5-6-12-9/h7H,3-6H2,1-2H3,(H2,10,11,12) |
| InChIKey | NBZCTHDKAZFIFG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one (CID 58774108) is 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one is CC(C)C(=O)CCNC1=NCCN1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one?
The InChIKey is NBZCTHDKAZFIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-7(2)8(13)3-4-10-9-11-5-6-12-9/h7H,3-6H2,1-2H3,(H2,10,11,12).
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one?
1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one has a molecular weight of 183.25 g/mol, XLogP of 0.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-ylamino)-4-methylpentan-3-one is sourced from PubChem (CID 58774108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).