C8H17N3O — CID 130685314
(2R)-2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butan-1-ol (PubChem CID 130685314) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is (2R)-2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butan-1-ol.
| Compound Name | (2R)-2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 130685314 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (2R)-2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)butan-1-ol |
| SMILES | CC[C@H](CO)NC1=NCCCN1 |
| InChI | InChI=1S/C8H17N3O/c1-2-7(6-12)11-8-9-4-3-5-10-8/h7,12H,2-6H2,1H3,(H2,9,10,11)/t7-/m1/s1 |
| InChIKey | RQTJDFZEDZKIOB-SSDOTTSWSA-N |
| XLogP | -0.30 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |