About 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine
2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine (PubChem CID 114401749) has the molecular formula C9H20N4
and a molecular weight of 184.29 g/mol. Its IUPAC name is 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine |
| PubChem CID | 114401749 |
| Molecular Formula | C9H20N4 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine |
| SMILES | CC(C)CC(CN)NC1=NCCN1 |
| InChI | InChI=1S/C9H20N4/c1-7(2)5-8(6-10)13-9-11-3-4-12-9/h7-8H,3-6,10H2,1-2H3,(H2,11,12,13) |
| InChIKey | SNLHYXUCCGBBLU-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine?
The IUPAC name of 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine (CID 114401749) is 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine.
What is the SMILES notation for 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine?
The canonical SMILES for 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine is CC(C)CC(CN)NC1=NCCN1.
What is the InChIKey of 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine?
The InChIKey is SNLHYXUCCGBBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N4/c1-7(2)5-8(6-10)13-9-11-3-4-12-9/h7-8H,3-6,10H2,1-2H3,(H2,11,12,13).
What are the key properties of 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine?
2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine has a molecular weight of 184.29 g/mol, XLogP of -0.09, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylpentane-1,2-diamine is sourced from PubChem (CID 114401749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).