C10H12BrN3 — CID 131012420
N-(4-bromophenyl)-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 131012420) has the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. Its IUPAC name is N-(4-bromophenyl)-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-(4-bromophenyl)-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 131012420 |
| Molecular Formula | C10H12BrN3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-(4-bromophenyl)-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | Brc1ccc(NC2=NCCCN2)cc1 |
| InChI | InChI=1S/C10H12BrN3/c11-8-2-4-9(5-3-8)14-10-12-6-1-7-13-10/h2-5H,1,6-7H2,(H2,12,13,14) |
| InChIKey | MQIYNRKLGABABX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |