C10H11BrN2Se — CID 11347682
N-(4-bromophenyl)-5,6-dihydro-4H-1,3-selenazin-2-amine (PubChem CID 11347682) has the molecular formula C10H11BrN2Se and a molecular weight of 318.08 g/mol. Its IUPAC name is N-(4-bromophenyl)-5,6-dihydro-4H-1,3-selenazin-2-amine.
| Compound Name | N-(4-bromophenyl)-5,6-dihydro-4H-1,3-selenazin-2-amine |
|---|---|
| PubChem CID | 11347682 |
| Molecular Formula | C10H11BrN2Se |
| Molecular Weight | 318.08 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | N-(4-bromophenyl)-5,6-dihydro-4H-1,3-selenazin-2-amine |
| SMILES | Brc1ccc(NC2=NCCC[Se]2)cc1 |
| InChI | InChI=1S/C10H11BrN2Se/c11-8-2-4-9(5-3-8)13-10-12-6-1-7-14-10/h2-5H,1,6-7H2,(H,12,13) |
| InChIKey | JTMDJLMLWBLCCH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.08 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|