C11H13BrN2 — CID 126982340
2-[(4-bromophenyl)methyl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 126982340) has the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-[(4-bromophenyl)methyl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 126982340 |
| Molecular Formula | C11H13BrN2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | Brc1ccc(CC2=NCCCN2)cc1 |
| InChI | InChI=1S/C11H13BrN2/c12-10-4-2-9(3-5-10)8-11-13-6-1-7-14-11/h2-5H,1,6-8H2,(H,13,14) |
| InChIKey | YGFMBVVFVLWADF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |