C26H26FN3O2 — CID 158653331
1-(6-amino-2-fluoro-3-pyridinyl)-2-[4-[[3-[(5-methyl-2-pyridinyl)oxy]phenyl]methylidene]cyclohexyl]ethanone (PubChem CID 158653331) has the molecular formula C26H26FN3O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-(6-amino-2-fluoro-3-pyridinyl)-2-[4-[[3-[(5-methyl-2-pyridinyl)oxy]phenyl]methylidene]cyclohexyl]ethanone.
| Compound Name | 1-(6-amino-2-fluoro-3-pyridinyl)-2-[4-[[3-[(5-methyl-2-pyridinyl)oxy]phenyl]methylidene]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 158653331 |
| Molecular Formula | C26H26FN3O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-(6-amino-2-fluoro-3-pyridinyl)-2-[4-[[3-[(5-methyl-2-pyridinyl)oxy]phenyl]methylidene]cyclohexyl]ethanone |
| SMILES | Cc1ccc(Oc2cccc(C=C3CCC(CC(=O)c4ccc(N)nc4F)CC3)c2)nc1 |
| InChI | InChI=1S/C26H26FN3O2/c1-17-5-12-25(29-16-17)32-21-4-2-3-20(14-21)13-18-6-8-19(9-7-18)15-23(31)22-10-11-24(28)30-26(22)27/h2-5,10-14,16,19H,6-9,15H2,1H3,(H2,28,30)/b18-13- |
| InChIKey | KOQZBHIVYWYZBI-AQTBWJFISA-N |
| XLogP | 6.15 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|