C34H25N5O5S — CID 158654357
8-amino-5H-benzo[b][1,4]benzoxazepin-6-one;N-[(6-oxo-5H-benzo[b][1,4]benzoxazepin-8-yl)carbamothioyl]benzamide (PubChem CID 158654357) has the molecular formula C34H25N5O5S and a molecular weight of 615.67 g/mol. Its IUPAC name is 8-amino-5H-benzo[b][1,4]benzoxazepin-6-one;N-[(6-oxo-5H-benzo[b][1,4]benzoxazepin-8-yl)carbamothioyl]benzamide.
| Compound Name | 8-amino-5H-benzo[b][1,4]benzoxazepin-6-one;N-[(6-oxo-5H-benzo[b][1,4]benzoxazepin-8-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 158654357 |
| Molecular Formula | C34H25N5O5S |
| Molecular Weight | 615.67 g/mol |
| Exact Mass | 615.16 |
| IUPAC Name | 8-amino-5H-benzo[b][1,4]benzoxazepin-6-one;N-[(6-oxo-5H-benzo[b][1,4]benzoxazepin-8-yl)carbamothioyl]benzamide |
| SMILES | Nc1ccc2c(c1)C(=O)Nc1ccccc1O2.O=C(NC(=S)Nc1ccc2c(c1)C(=O)Nc1ccccc1O2)c1ccccc1 |
| InChI | InChI=1S/C21H15N3O3S.C13H10N2O2/c25-19(13-6-2-1-3-7-13)24-21(28)22-14-10-11-17-15(12-14)20(26)23-16-8-4-5-9-18(16)27-17;14-8-5-6-11-9(7-8)13(16)15-10-3-1-2-4-12(10)17-11/h1-12H,(H,23,26)(H2,22,24,25,28);1-7H,14H2,(H,15,16) |
| InChIKey | IBYFQWYIUGUCQZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.67 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|