C52H49N5O7 — CID 158656359
ethyl 3-[[2-[(2-ethoxycarbonyl-1H-indol-3-yl)methyl]-1H-indol-3-yl]methyl]-1H-indole-2-carboxylate;ethyl 3-(hydroxymethyl)-1H-indole-2-carboxylate;1H-indole (PubChem CID 158656359) has the molecular formula C52H49N5O7 and a molecular weight of 855.99 g/mol. Its IUPAC name is ethyl 3-[[2-[(2-ethoxycarbonyl-1H-indol-3-yl)methyl]-1H-indol-3-yl]methyl]-1H-indole-2-carboxylate;ethyl 3-(hydroxymethyl)-1H-indole-2-carboxylate;1H-indole.
| Compound Name | ethyl 3-[[2-[(2-ethoxycarbonyl-1H-indol-3-yl)methyl]-1H-indol-3-yl]methyl]-1H-indole-2-carboxylate;ethyl 3-(hydroxymethyl)-1H-indole-2-carboxylate;1H-indole |
|---|---|
| PubChem CID | 158656359 |
| Molecular Formula | C52H49N5O7 |
| Molecular Weight | 855.99 g/mol |
| Exact Mass | 855.36 |
| IUPAC Name | ethyl 3-[[2-[(2-ethoxycarbonyl-1H-indol-3-yl)methyl]-1H-indol-3-yl]methyl]-1H-indole-2-carboxylate;ethyl 3-(hydroxymethyl)-1H-indole-2-carboxylate;1H-indole |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1CO.CCOC(=O)c1[nH]c2ccccc2c1Cc1[nH]c2ccccc2c1Cc1c(C(=O)OCC)[nH]c2ccccc12.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C32H29N3O4.C12H13NO3.C8H7N/c1-3-38-31(36)29-23(20-12-6-9-15-26(20)34-29)17-22-19-11-5-8-14-25(19)33-28(22)18-24-21-13-7-10-16-27(21)35-30(24)32(37)39-4-2;1-2-16-12(15)11-9(7-14)8-5-3-4-6-10(8)13-11;1-2-4-8-7(3-1)5-6-9-8/h5-16,33-35H,3-4,17-18H2,1-2H3;3-6,13-14H,2,7H2,1H3;1-6,9H |
| InChIKey | ICEMLHIBBARFIF-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 178.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.99 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|