C28H30N2O4S2 — CID 158657006
3-[(4-methylsulfanylphenoxy)methyl]aniline;3-[(4-methylsulfonylphenoxy)methyl]aniline (PubChem CID 158657006) has the molecular formula C28H30N2O4S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 3-[(4-methylsulfanylphenoxy)methyl]aniline;3-[(4-methylsulfonylphenoxy)methyl]aniline.
| Compound Name | 3-[(4-methylsulfanylphenoxy)methyl]aniline;3-[(4-methylsulfonylphenoxy)methyl]aniline |
|---|---|
| PubChem CID | 158657006 |
| Molecular Formula | C28H30N2O4S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 3-[(4-methylsulfanylphenoxy)methyl]aniline;3-[(4-methylsulfonylphenoxy)methyl]aniline |
| SMILES | CS(=O)(=O)c1ccc(OCc2cccc(N)c2)cc1.CSc1ccc(OCc2cccc(N)c2)cc1 |
| InChI | InChI=1S/C14H15NO3S.C14H15NOS/c1-19(16,17)14-7-5-13(6-8-14)18-10-11-3-2-4-12(15)9-11;1-17-14-7-5-13(6-8-14)16-10-11-3-2-4-12(15)9-11/h2-9H,10,15H2,1H3;2-9H,10,15H2,1H3 |
| InChIKey | ICGOENSOMJRDNJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|