C22H20N4O3 — CID 158658271
[(1S)-1-[8-(1-methylpyrazol-4-yl)-1-oxo-2-phenylisoquinolin-3-yl]ethyl] carbamate (PubChem CID 158658271) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is [(1S)-1-[8-(1-methylpyrazol-4-yl)-1-oxo-2-phenylisoquinolin-3-yl]ethyl] carbamate.
| Compound Name | [(1S)-1-[8-(1-methylpyrazol-4-yl)-1-oxo-2-phenylisoquinolin-3-yl]ethyl] carbamate |
|---|---|
| PubChem CID | 158658271 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [(1S)-1-[8-(1-methylpyrazol-4-yl)-1-oxo-2-phenylisoquinolin-3-yl]ethyl] carbamate |
| SMILES | C[C@H](OC(N)=O)c1cc2cccc(-c3cnn(C)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H20N4O3/c1-14(29-22(23)28)19-11-15-7-6-10-18(16-12-24-25(2)13-16)20(15)21(27)26(19)17-8-4-3-5-9-17/h3-14H,1-2H3,(H2,23,28)/t14-/m0/s1 |
| InChIKey | ICKRXQWDJAEZGR-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |