C23H24N2O3Si — CID 175601120
1-[1-oxo-2-phenyl-8-(2-trimethylsilylethynyl)isoquinolin-3-yl]ethyl carbamate (PubChem CID 175601120) has the molecular formula C23H24N2O3Si and a molecular weight of 404.54 g/mol. Its IUPAC name is 1-[1-oxo-2-phenyl-8-(2-trimethylsilylethynyl)isoquinolin-3-yl]ethyl carbamate.
| Compound Name | 1-[1-oxo-2-phenyl-8-(2-trimethylsilylethynyl)isoquinolin-3-yl]ethyl carbamate |
|---|---|
| PubChem CID | 175601120 |
| Molecular Formula | C23H24N2O3Si |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-[1-oxo-2-phenyl-8-(2-trimethylsilylethynyl)isoquinolin-3-yl]ethyl carbamate |
| SMILES | CC(OC(N)=O)c1cc2cccc(C#C[Si](C)(C)C)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C23H24N2O3Si/c1-16(28-23(24)27)20-15-18-10-8-9-17(13-14-29(2,3)4)21(18)22(26)25(20)19-11-6-5-7-12-19/h5-12,15-16H,1-4H3,(H2,24,27) |
| InChIKey | LUNIMLWIOYSSKC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|