C14H14F6N4O4 — CID 158658547
methyl 2-(2,2,2-trifluoroethyl)pyrazole-3-carboxylate (PubChem CID 158658547) has the molecular formula C14H14F6N4O4 and a molecular weight of 416.28 g/mol. Its IUPAC name is methyl 2-(2,2,2-trifluoroethyl)pyrazole-3-carboxylate.
| Compound Name | methyl 2-(2,2,2-trifluoroethyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 158658547 |
| Molecular Formula | C14H14F6N4O4 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | methyl 2-(2,2,2-trifluoroethyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1ccnn1CC(F)(F)F.COC(=O)c1ccnn1CC(F)(F)F |
| InChI | InChI=1S/2C7H7F3N2O2/c2*1-14-6(13)5-2-3-11-12(5)4-7(8,9)10/h2*2-3H,4H2,1H3 |
| InChIKey | ICLQCJLLTBJGSQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |