C9H12ClN3O2 — CID 154983937
methyl 2-[2-(aminomethyl)-3-chloroprop-2-enyl]pyrazole-3-carboxylate (PubChem CID 154983937) has the molecular formula C9H12ClN3O2 and a molecular weight of 229.67 g/mol. Its IUPAC name is methyl 2-[2-(aminomethyl)-3-chloroprop-2-enyl]pyrazole-3-carboxylate.
| Compound Name | methyl 2-[2-(aminomethyl)-3-chloroprop-2-enyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 154983937 |
| Molecular Formula | C9H12ClN3O2 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | methyl 2-[2-(aminomethyl)-3-chloroprop-2-enyl]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1ccnn1CC(=CCl)CN |
| InChI | InChI=1S/C9H12ClN3O2/c1-15-9(14)8-2-3-12-13(8)6-7(4-10)5-11/h2-4H,5-6,11H2,1H3 |
| InChIKey | VNKMRVKIAPFBAZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |