C12H20ClN3O2 — CID 178139555
tert-butyl N-[1-(5-chloropyrazol-1-yl)-2-methylpropan-2-yl]carbamate (PubChem CID 178139555) has the molecular formula C12H20ClN3O2 and a molecular weight of 273.76 g/mol. Its IUPAC name is tert-butyl N-[1-(5-chloropyrazol-1-yl)-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-chloropyrazol-1-yl)-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 178139555 |
| Molecular Formula | C12H20ClN3O2 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | tert-butyl N-[1-(5-chloropyrazol-1-yl)-2-methylpropan-2-yl]carbamate |
| SMILES | CC(C)(Cn1nccc1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20ClN3O2/c1-11(2,3)18-10(17)15-12(4,5)8-16-9(13)6-7-14-16/h6-7H,8H2,1-5H3,(H,15,17) |
| InChIKey | QSUCASYCGBDPRC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |