C17H24N2O4 — CID 158660630
2-[1,3-dioxo-4,6-bis(prop-1-enyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 158660630) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[1,3-dioxo-4,6-bis(prop-1-enyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[1,3-dioxo-4,6-bis(prop-1-enyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 158660630 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[1,3-dioxo-4,6-bis(prop-1-enyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | CC=CC1CC(C=CC)C2C(=O)N(CC(=O)NCCO)C(=O)C12 |
| InChI | InChI=1S/C17H24N2O4/c1-3-5-11-9-12(6-4-2)15-14(11)16(22)19(17(15)23)10-13(21)18-7-8-20/h3-6,11-12,14-15,20H,7-10H2,1-2H3,(H,18,21) |
| InChIKey | ICSCZSKMPMJKSC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|