C18H22O4S — CID 158661658
bicyclo[2.2.1]heptane-2-carboxylic acid;3-(4-methylsulfanylphenyl)prop-2-enoic acid (PubChem CID 158661658) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane-2-carboxylic acid;3-(4-methylsulfanylphenyl)prop-2-enoic acid.
| Compound Name | bicyclo[2.2.1]heptane-2-carboxylic acid;3-(4-methylsulfanylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 158661658 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | bicyclo[2.2.1]heptane-2-carboxylic acid;3-(4-methylsulfanylphenyl)prop-2-enoic acid |
| SMILES | CSc1ccc(C=CC(=O)O)cc1.O=C(O)C1CC2CCC1C2 |
| InChI | InChI=1S/C10H10O2S.C8H12O2/c1-13-9-5-2-8(3-6-9)4-7-10(11)12;9-8(10)7-4-5-1-2-6(7)3-5/h2-7H,1H3,(H,11,12);5-7H,1-4H2,(H,9,10) |
| InChIKey | ICVHNQLPFBFIDS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|