hypochlorous acid;iodic acid

H2ClIO4 — CID 158662456

IUPAChypochlorous acid;iodic acid
SMILESOCl.[O-][I+2]([O-])O
InChIInChI=1S/ClHO.HIO3/c1-2;2-1(3)4/h2H;2H
InChIKeyKEUSUPATVXAULE-UHFFFAOYSA-N
MW228.37 g/mol
LogP-5.80
Rot. Bonds

About hypochlorous acid;iodic acid

hypochlorous acid;iodic acid (PubChem CID 158662456) has the molecular formula H2ClIO4 and a molecular weight of 228.37 g/mol. Its IUPAC name is hypochlorous acid;iodic acid.

Molecular Properties

Compound Namehypochlorous acid;iodic acid
PubChem CID158662456
Molecular FormulaH2ClIO4
Molecular Weight228.37 g/mol
Exact Mass227.87
IUPAC Namehypochlorous acid;iodic acid
SMILESOCl.[O-][I+2]([O-])O
InChIInChI=1S/ClHO.HIO3/c1-2;2-1(3)4/h2H;2H
InChIKeyKEUSUPATVXAULE-UHFFFAOYSA-N
XLogP-5.80
TPSA86.58 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.37
LogP ≤ 5-5.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze hypochlorous acid;iodic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hypochlorous acid;iodic acid?
The IUPAC name of hypochlorous acid;iodic acid (CID 158662456) is hypochlorous acid;iodic acid.
What is the SMILES notation for hypochlorous acid;iodic acid?
The canonical SMILES for hypochlorous acid;iodic acid is OCl.[O-][I+2]([O-])O.
What is the InChIKey of hypochlorous acid;iodic acid?
The InChIKey is KEUSUPATVXAULE-UHFFFAOYSA-N. The full InChI is InChI=1S/ClHO.HIO3/c1-2;2-1(3)4/h2H;2H.
What are the key properties of hypochlorous acid;iodic acid?
hypochlorous acid;iodic acid has a molecular weight of 228.37 g/mol, XLogP of -5.80, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hypochlorous acid;iodic acid is sourced from PubChem (CID 158662456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).