About iodic acid;propan-2-amine
iodic acid;propan-2-amine (PubChem CID 161358666) has the molecular formula C3H10INO3
and a molecular weight of 235.02 g/mol. Its IUPAC name is iodic acid;propan-2-amine.
Molecular Properties
| Compound Name | iodic acid;propan-2-amine |
| PubChem CID | 161358666 |
| Molecular Formula | C3H10INO3 |
| Molecular Weight | 235.02 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | iodic acid;propan-2-amine |
| SMILES | CC(C)N.[O-][I+2]([O-])O |
| InChI | InChI=1S/C3H9N.HIO3/c1-3(2)4;2-1(3)4/h3H,4H2,1-2H3;2H |
| InChIKey | VOWNYEKZYXMVIY-UHFFFAOYSA-N |
| XLogP | -5.58 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.02 |
| LogP ≤ 5 | -5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodic acid;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodic acid;propan-2-amine?
The IUPAC name of iodic acid;propan-2-amine (CID 161358666) is iodic acid;propan-2-amine.
What is the SMILES notation for iodic acid;propan-2-amine?
The canonical SMILES for iodic acid;propan-2-amine is CC(C)N.[O-][I+2]([O-])O.
What is the InChIKey of iodic acid;propan-2-amine?
The InChIKey is VOWNYEKZYXMVIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.HIO3/c1-3(2)4;2-1(3)4/h3H,4H2,1-2H3;2H.
What are the key properties of iodic acid;propan-2-amine?
iodic acid;propan-2-amine has a molecular weight of 235.02 g/mol, XLogP of -5.58, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iodic acid;propan-2-amine is sourced from PubChem (CID 161358666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).