C58H50N6 — CID 158665720
9-[2-(4,6-diphenylpyrimidin-2-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-methylphenyl]-1,2,3,4,5,6,7,8-octamethylcarbazole (PubChem CID 158665720) has the molecular formula C58H50N6 and a molecular weight of 831.08 g/mol. Its IUPAC name is 9-[2-(4,6-diphenylpyrimidin-2-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-methylphenyl]-1,2,3,4,5,6,7,8-octamethylcarbazole.
| Compound Name | 9-[2-(4,6-diphenylpyrimidin-2-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-methylphenyl]-1,2,3,4,5,6,7,8-octamethylcarbazole |
|---|---|
| PubChem CID | 158665720 |
| Molecular Formula | C58H50N6 |
| Molecular Weight | 831.08 g/mol |
| Exact Mass | 830.41 |
| IUPAC Name | 9-[2-(4,6-diphenylpyrimidin-2-yl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-methylphenyl]-1,2,3,4,5,6,7,8-octamethylcarbazole |
| SMILES | Cc1cc(-n2c3c(C)c(C)c(C)c(C)c3c3c(C)c(C)c(C)c(C)c32)c(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C58H50N6/c1-33-30-50(64-53-40(8)36(4)34(2)38(6)51(53)52-39(7)35(3)37(5)41(9)54(52)64)47(58-59-48(42-22-14-10-15-23-42)32-49(60-58)43-24-16-11-17-25-43)31-46(33)57-62-55(44-26-18-12-19-27-44)61-56(63-57)45-28-20-13-21-29-45/h10-32H,1-9H3 |
| InChIKey | DHZZAMCKLFSVFP-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.08 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |