About 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride
3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride (PubChem CID 158666373) has the molecular formula C13H14BClF3NO4
and a molecular weight of 351.52 g/mol. Its IUPAC name is 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride |
| PubChem CID | 158666373 |
| Molecular Formula | C13H14BClF3NO4 |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride |
| SMILES | Cl.Nc1cccc(O)c1-c1ccccc1C(F)(F)F.OB(O)O |
| InChI | InChI=1S/C13H10F3NO.BH3O3.ClH/c14-13(15,16)9-5-2-1-4-8(9)12-10(17)6-3-7-11(12)18;2-1(3)4;/h1-7,18H,17H2;2-4H;1H |
| InChIKey | GTFKEWXDCFJHNJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride?
The IUPAC name of 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride (CID 158666373) is 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride.
What is the SMILES notation for 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride?
The canonical SMILES for 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride is Cl.Nc1cccc(O)c1-c1ccccc1C(F)(F)F.OB(O)O.
What is the InChIKey of 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride?
The InChIKey is GTFKEWXDCFJHNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3NO.BH3O3.ClH/c14-13(15,16)9-5-2-1-4-8(9)12-10(17)6-3-7-11(12)18;2-1(3)4;/h1-7,18H,17H2;2-4H;1H.
What are the key properties of 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride?
3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride has a molecular weight of 351.52 g/mol, XLogP of 2.03, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-[2-(trifluoromethyl)phenyl]phenol;boric acid;hydrochloride is sourced from PubChem (CID 158666373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).