About diethyl(methoxy)borane;oxolane
diethyl(methoxy)borane;oxolane (PubChem CID 158668575) has the molecular formula C9H21BO2
and a molecular weight of 172.08 g/mol. Its IUPAC name is diethyl(methoxy)borane;oxolane.
Molecular Properties
| Compound Name | diethyl(methoxy)borane;oxolane |
| PubChem CID | 158668575 |
| Molecular Formula | C9H21BO2 |
| Molecular Weight | 172.08 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | diethyl(methoxy)borane;oxolane |
| SMILES | C1CCOC1.CCB(CC)OC |
| InChI | InChI=1S/C5H13BO.C4H8O/c1-4-6(5-2)7-3;1-2-4-5-3-1/h4-5H2,1-3H3;1-4H2 |
| InChIKey | IDQZAGGAUDZTLO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.08 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethyl(methoxy)borane;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(methoxy)borane;oxolane?
The IUPAC name of diethyl(methoxy)borane;oxolane (CID 158668575) is diethyl(methoxy)borane;oxolane.
What is the SMILES notation for diethyl(methoxy)borane;oxolane?
The canonical SMILES for diethyl(methoxy)borane;oxolane is C1CCOC1.CCB(CC)OC.
What is the InChIKey of diethyl(methoxy)borane;oxolane?
The InChIKey is IDQZAGGAUDZTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13BO.C4H8O/c1-4-6(5-2)7-3;1-2-4-5-3-1/h4-5H2,1-3H3;1-4H2.
What are the key properties of diethyl(methoxy)borane;oxolane?
diethyl(methoxy)borane;oxolane has a molecular weight of 172.08 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(methoxy)borane;oxolane is sourced from PubChem (CID 158668575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).