C33H29F6N3O3 — CID 158677835
(4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-[3-[4-(2-methoxyethoxy)phenyl]-2-pyridinyl]pentan-2-one (PubChem CID 158677835) has the molecular formula C33H29F6N3O3 and a molecular weight of 629.60 g/mol. Its IUPAC name is (4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-[3-[4-(2-methoxyethoxy)phenyl]-2-pyridinyl]pentan-2-one.
| Compound Name | (4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-[3-[4-(2-methoxyethoxy)phenyl]-2-pyridinyl]pentan-2-one |
|---|---|
| PubChem CID | 158677835 |
| Molecular Formula | C33H29F6N3O3 |
| Molecular Weight | 629.60 g/mol |
| Exact Mass | 629.21 |
| IUPAC Name | (4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-[3-[4-(2-methoxyethoxy)phenyl]-2-pyridinyl]pentan-2-one |
| SMILES | COCCOc1ccc(-c2cccnc2[C@@H](CC(=O)Cn2nc(C(F)F)c3c2C(F)(F)C2CC32)Cc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C33H29F6N3O3/c1-44-9-10-45-24-6-4-19(5-7-24)25-3-2-8-40-29(25)20(11-18-12-21(34)15-22(35)13-18)14-23(43)17-42-31-28(30(41-42)32(36)37)26-16-27(26)33(31,38)39/h2-8,12-13,15,20,26-27,32H,9-11,14,16-17H2,1H3/t20-,26?,27?/m1/s1 |
| InChIKey | IESZIJDKAFAOQD-RHKGEPBNSA-N |
| XLogP | 7.38 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|