C24H22BBrF8N6O2 — CID 158681092
2-bromo-3-fluoro-6-(trifluoromethyl)pyridine;3-fluoro-2-(1H-pyrazol-5-yl)-6-(trifluoromethyl)pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (PubChem CID 158681092) has the molecular formula C24H22BBrF8N6O2 and a molecular weight of 669.18 g/mol. Its IUPAC name is 2-bromo-3-fluoro-6-(trifluoromethyl)pyridine;3-fluoro-2-(1H-pyrazol-5-yl)-6-(trifluoromethyl)pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
| Compound Name | 2-bromo-3-fluoro-6-(trifluoromethyl)pyridine;3-fluoro-2-(1H-pyrazol-5-yl)-6-(trifluoromethyl)pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 158681092 |
| Molecular Formula | C24H22BBrF8N6O2 |
| Molecular Weight | 669.18 g/mol |
| Exact Mass | 668.10 |
| IUPAC Name | 2-bromo-3-fluoro-6-(trifluoromethyl)pyridine;3-fluoro-2-(1H-pyrazol-5-yl)-6-(trifluoromethyl)pyridine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| SMILES | CC1(C)OB(c2ccn[nH]2)OC1(C)C.Fc1ccc(C(F)(F)F)nc1-c1ccn[nH]1.Fc1ccc(C(F)(F)F)nc1Br |
| InChI | InChI=1S/C9H15BN2O2.C9H5F4N3.C6H2BrF4N/c1-8(2)9(3,4)14-10(13-8)7-5-6-11-12-7;10-5-1-2-7(9(11,12)13)15-8(5)6-3-4-14-16-6;7-5-3(8)1-2-4(12-5)6(9,10)11/h5-6H,1-4H3,(H,11,12);1-4H,(H,14,16);1-2H |
| InChIKey | IFDFNYKGNLQTSG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.18 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|