C30H41B2BrN6O4 — CID 158907001
2-(bromomethyl)pyridine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyridine (PubChem CID 158907001) has the molecular formula C30H41B2BrN6O4 and a molecular weight of 651.22 g/mol. Its IUPAC name is 2-(bromomethyl)pyridine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyridine.
| Compound Name | 2-(bromomethyl)pyridine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 158907001 |
| Molecular Formula | C30H41B2BrN6O4 |
| Molecular Weight | 651.22 g/mol |
| Exact Mass | 650.26 |
| IUPAC Name | 2-(bromomethyl)pyridine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyridine |
| SMILES | BrCc1ccccn1.CC1(C)OB(c2cn[nH]c2)OC1(C)C.CC1(C)OB(c2cnn(Cc3ccccn3)c2)OC1(C)C |
| InChI | InChI=1S/C15H20BN3O2.C9H15BN2O2.C6H6BrN/c1-14(2)15(3,4)21-16(20-14)12-9-18-19(10-12)11-13-7-5-6-8-17-13;1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7;7-5-6-3-1-2-4-8-6/h5-10H,11H2,1-4H3;5-6H,1-4H3,(H,11,12);1-4H,5H2 |
| InChIKey | JGDYYHQVUXUAEK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|