C24H34B2N4O4 — CID 159917662
1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (PubChem CID 159917662) has the molecular formula C24H34B2N4O4 and a molecular weight of 464.18 g/mol. Its IUPAC name is 1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole.
| Compound Name | 1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 159917662 |
| Molecular Formula | C24H34B2N4O4 |
| Molecular Weight | 464.18 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| SMILES | CC1(C)OB(c2cn[nH]c2)OC1(C)C.CC1(C)OB(c2cnn(-c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C15H19BN2O2.C9H15BN2O2/c1-14(2)15(3,4)20-16(19-14)12-10-17-18(11-12)13-8-6-5-7-9-13;1-8(2)9(3,4)14-10(13-8)7-5-11-12-6-7/h5-11H,1-4H3;5-6H,1-4H3,(H,11,12) |
| InChIKey | NXZLAGUOBYMJOH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.18 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|