C19H15ClF3NO3 — CID 158682860
4-(5-chloro-2-hydroxyphenyl)-3-ethoxy-1-methyl-7-(trifluoromethyl)quinolin-2-one (PubChem CID 158682860) has the molecular formula C19H15ClF3NO3 and a molecular weight of 397.78 g/mol. Its IUPAC name is 4-(5-chloro-2-hydroxyphenyl)-3-ethoxy-1-methyl-7-(trifluoromethyl)quinolin-2-one.
| Compound Name | 4-(5-chloro-2-hydroxyphenyl)-3-ethoxy-1-methyl-7-(trifluoromethyl)quinolin-2-one |
|---|---|
| PubChem CID | 158682860 |
| Molecular Formula | C19H15ClF3NO3 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-(5-chloro-2-hydroxyphenyl)-3-ethoxy-1-methyl-7-(trifluoromethyl)quinolin-2-one |
| SMILES | CCOc1c(-c2cc(Cl)ccc2O)c2ccc(C(F)(F)F)cc2n(C)c1=O |
| InChI | InChI=1S/C19H15ClF3NO3/c1-3-27-17-16(13-9-11(20)5-7-15(13)25)12-6-4-10(19(21,22)23)8-14(12)24(2)18(17)26/h4-9,25H,3H2,1-2H3 |
| InChIKey | IFIZFIUWHPFFJM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |