C18H25F3N4O2S — CID 158683083
6-[(2-tert-butylhydrazinyl)methyl]-5-methyl-3-[(1S,2S)-2-methylcyclopropyl]-1-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 158683083) has the molecular formula C18H25F3N4O2S and a molecular weight of 418.49 g/mol. Its IUPAC name is 6-[(2-tert-butylhydrazinyl)methyl]-5-methyl-3-[(1S,2S)-2-methylcyclopropyl]-1-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-[(2-tert-butylhydrazinyl)methyl]-5-methyl-3-[(1S,2S)-2-methylcyclopropyl]-1-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 158683083 |
| Molecular Formula | C18H25F3N4O2S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 6-[(2-tert-butylhydrazinyl)methyl]-5-methyl-3-[(1S,2S)-2-methylcyclopropyl]-1-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(CNNC(C)(C)C)sc2c1c(=O)n([C@H]1C[C@@H]1C)c(=O)n2CC(F)(F)F |
| InChI | InChI=1S/C18H25F3N4O2S/c1-9-6-11(9)25-14(26)13-10(2)12(7-22-23-17(3,4)5)28-15(13)24(16(25)27)8-18(19,20)21/h9,11,22-23H,6-8H2,1-5H3/t9-,11-/m0/s1 |
| InChIKey | IFJSZTJGMREUFD-ONGXEEELSA-N |
| XLogP | 3.07 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|