C20H24FNO6 — CID 158683897
methyl 3-[(3S,3aS)-6-[(3S,4R)-3,4-dihydroxycyclohexyl]-7-fluoro-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]propanoate (PubChem CID 158683897) has the molecular formula C20H24FNO6 and a molecular weight of 393.41 g/mol. Its IUPAC name is methyl 3-[(3S,3aS)-6-[(3S,4R)-3,4-dihydroxycyclohexyl]-7-fluoro-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]propanoate.
| Compound Name | methyl 3-[(3S,3aS)-6-[(3S,4R)-3,4-dihydroxycyclohexyl]-7-fluoro-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]propanoate |
|---|---|
| PubChem CID | 158683897 |
| Molecular Formula | C20H24FNO6 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | methyl 3-[(3S,3aS)-6-[(3S,4R)-3,4-dihydroxycyclohexyl]-7-fluoro-1-oxo-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]propanoate |
| SMILES | COC(=O)CC[C@@H]1OC(=O)N2c3cc(F)c(C4CC[C@@H](O)[C@@H](O)C4)cc3C[C@@H]12 |
| InChI | InChI=1S/C20H24FNO6/c1-27-19(25)5-4-18-15-7-11-6-12(10-2-3-16(23)17(24)8-10)13(21)9-14(11)22(15)20(26)28-18/h6,9-10,15-18,23-24H,2-5,7-8H2,1H3/t10?,15-,16+,17-,18-/m0/s1 |
| InChIKey | OVOWDXNRKTUVKD-FSLGZRCKSA-N |
| XLogP | 2.02 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |