About (4-benzylsulfonylphenyl)boronic acid;methane
(4-benzylsulfonylphenyl)boronic acid;methane (PubChem CID 158684616) has the molecular formula C14H17BO4S
and a molecular weight of 292.17 g/mol. Its IUPAC name is (4-benzylsulfonylphenyl)boronic acid;methane.
Molecular Properties
| Compound Name | (4-benzylsulfonylphenyl)boronic acid;methane |
| PubChem CID | 158684616 |
| Molecular Formula | C14H17BO4S |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (4-benzylsulfonylphenyl)boronic acid;methane |
| SMILES | C.O=S(=O)(Cc1ccccc1)c1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C13H13BO4S.CH4/c15-14(16)12-6-8-13(9-7-12)19(17,18)10-11-4-2-1-3-5-11;/h1-9,15-16H,10H2;1H4 |
| InChIKey | IFONZMAYZSHTTF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-benzylsulfonylphenyl)boronic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzylsulfonylphenyl)boronic acid;methane?
The IUPAC name of (4-benzylsulfonylphenyl)boronic acid;methane (CID 158684616) is (4-benzylsulfonylphenyl)boronic acid;methane.
What is the SMILES notation for (4-benzylsulfonylphenyl)boronic acid;methane?
The canonical SMILES for (4-benzylsulfonylphenyl)boronic acid;methane is C.O=S(=O)(Cc1ccccc1)c1ccc(B(O)O)cc1.
What is the InChIKey of (4-benzylsulfonylphenyl)boronic acid;methane?
The InChIKey is IFONZMAYZSHTTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BO4S.CH4/c15-14(16)12-6-8-13(9-7-12)19(17,18)10-11-4-2-1-3-5-11;/h1-9,15-16H,10H2;1H4.
What are the key properties of (4-benzylsulfonylphenyl)boronic acid;methane?
(4-benzylsulfonylphenyl)boronic acid;methane has a molecular weight of 292.17 g/mol, XLogP of 0.98, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzylsulfonylphenyl)boronic acid;methane is sourced from PubChem (CID 158684616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).