C32H32F4N6OSi — CID 158688164
6,7-difluoro-5-phenyl-1H-indazol-3-amine;6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-amine (PubChem CID 158688164) has the molecular formula C32H32F4N6OSi and a molecular weight of 620.73 g/mol. Its IUPAC name is 6,7-difluoro-5-phenyl-1H-indazol-3-amine;6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-amine.
| Compound Name | 6,7-difluoro-5-phenyl-1H-indazol-3-amine;6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-amine |
|---|---|
| PubChem CID | 158688164 |
| Molecular Formula | C32H32F4N6OSi |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | 6,7-difluoro-5-phenyl-1H-indazol-3-amine;6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-amine |
| SMILES | C[Si](C)(C)CCOCn1nc(N)c2cc(-c3ccccc3)c(F)c(F)c21.Nc1n[nH]c2c(F)c(F)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C19H23F2N3OSi.C13H9F2N3/c1-26(2,3)10-9-25-12-24-18-15(19(22)23-24)11-14(16(20)17(18)21)13-7-5-4-6-8-13;14-10-8(7-4-2-1-3-5-7)6-9-12(11(10)15)17-18-13(9)16/h4-8,11H,9-10,12H2,1-3H3,(H2,22,23);1-6H,(H3,16,17,18) |
| InChIKey | IFZRDNORSLNUTJ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|