C42H52F4N6O3Si2 — CID 159008844
6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-amine;N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide (PubChem CID 159008844) has the molecular formula C42H52F4N6O3Si2 and a molecular weight of 821.08 g/mol. Its IUPAC name is 6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-amine;N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide.
| Compound Name | 6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-amine;N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide |
|---|---|
| PubChem CID | 159008844 |
| Molecular Formula | C42H52F4N6O3Si2 |
| Molecular Weight | 821.08 g/mol |
| Exact Mass | 820.36 |
| IUPAC Name | 6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-amine;N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide |
| SMILES | CCCC(=O)Nc1nn(COCC[Si](C)(C)C)c2c(F)c(F)c(-c3ccccc3)cc12.C[Si](C)(C)CCOCn1nc(N)c2cc(-c3ccccc3)c(F)c(F)c21 |
| InChI | InChI=1S/C23H29F2N3O2Si.C19H23F2N3OSi/c1-5-9-19(29)26-23-18-14-17(16-10-7-6-8-11-16)20(24)21(25)22(18)28(27-23)15-30-12-13-31(2,3)4;1-26(2,3)10-9-25-12-24-18-15(19(22)23-24)11-14(16(20)17(18)21)13-7-5-4-6-8-13/h6-8,10-11,14H,5,9,12-13,15H2,1-4H3,(H,26,27,29);4-8,11H,9-10,12H2,1-3H3,(H2,22,23) |
| InChIKey | JSGISZCYCLUJLZ-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.08 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|