C24H30F2N4O2Si — CID 86593374
N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]pyrrolidine-1-carboxamide (PubChem CID 86593374) has the molecular formula C24H30F2N4O2Si and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 86593374 |
| Molecular Formula | C24H30F2N4O2Si |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]pyrrolidine-1-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1nc(NC(=O)N2CCCC2)c2cc(-c3ccccc3)c(F)c(F)c21 |
| InChI | InChI=1S/C24H30F2N4O2Si/c1-33(2,3)14-13-32-16-30-22-19(23(28-30)27-24(31)29-11-7-8-12-29)15-18(20(25)21(22)26)17-9-5-4-6-10-17/h4-6,9-10,15H,7-8,11-14,16H2,1-3H3,(H,27,28,31) |
| InChIKey | CBJBYMVEYUJAOZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|