C17H25F2N3O2Si — CID 10248536
N-[6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide (PubChem CID 10248536) has the molecular formula C17H25F2N3O2Si and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide.
| Compound Name | N-[6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide |
|---|---|
| PubChem CID | 10248536 |
| Molecular Formula | C17H25F2N3O2Si |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-[6,7-difluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]butanamide |
| SMILES | CCCC(=O)Nc1nn(COCC[Si](C)(C)C)c2c(F)c(F)ccc12 |
| InChI | InChI=1S/C17H25F2N3O2Si/c1-5-6-14(23)20-17-12-7-8-13(18)15(19)16(12)22(21-17)11-24-9-10-25(2,3)4/h7-8H,5-6,9-11H2,1-4H3,(H,20,21,23) |
| InChIKey | XWVSKNXUROZXMZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|