C25H32F2N4O2Si — CID 86593373
N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]piperidine-1-carboxamide (PubChem CID 86593373) has the molecular formula C25H32F2N4O2Si and a molecular weight of 486.64 g/mol. Its IUPAC name is N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]piperidine-1-carboxamide.
| Compound Name | N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86593373 |
| Molecular Formula | C25H32F2N4O2Si |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-[6,7-difluoro-5-phenyl-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]piperidine-1-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1nc(NC(=O)N2CCCCC2)c2cc(-c3ccccc3)c(F)c(F)c21 |
| InChI | InChI=1S/C25H32F2N4O2Si/c1-34(2,3)15-14-33-17-31-23-20(24(29-31)28-25(32)30-12-8-5-9-13-30)16-19(21(26)22(23)27)18-10-6-4-7-11-18/h4,6-7,10-11,16H,5,8-9,12-15,17H2,1-3H3,(H,28,29,32) |
| InChIKey | DBQRPLKMEVLZCF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|