About acetylene;2-hydroxyacetic acid
acetylene;2-hydroxyacetic acid (PubChem CID 158693227) has the molecular formula C4H6O3
and a molecular weight of 102.09 g/mol. Its IUPAC name is acetylene;2-hydroxyacetic acid.
Molecular Properties
| Compound Name | acetylene;2-hydroxyacetic acid |
| PubChem CID | 158693227 |
| Molecular Formula | C4H6O3 |
| Molecular Weight | 102.09 g/mol |
| Exact Mass | 102.03 |
| IUPAC Name | acetylene;2-hydroxyacetic acid |
| SMILES | C#C.O=C(O)CO |
| InChI | InChI=1S/C2H4O3.C2H2/c3-1-2(4)5;1-2/h3H,1H2,(H,4,5);1-2H |
| InChIKey | IGPQFHRLSKSRCW-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.09 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;2-hydroxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;2-hydroxyacetic acid?
The IUPAC name of acetylene;2-hydroxyacetic acid (CID 158693227) is acetylene;2-hydroxyacetic acid.
What is the SMILES notation for acetylene;2-hydroxyacetic acid?
The canonical SMILES for acetylene;2-hydroxyacetic acid is C#C.O=C(O)CO.
What is the InChIKey of acetylene;2-hydroxyacetic acid?
The InChIKey is IGPQFHRLSKSRCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3.C2H2/c3-1-2(4)5;1-2/h3H,1H2,(H,4,5);1-2H.
What are the key properties of acetylene;2-hydroxyacetic acid?
acetylene;2-hydroxyacetic acid has a molecular weight of 102.09 g/mol, XLogP of -0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;2-hydroxyacetic acid is sourced from PubChem (CID 158693227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).