About 2-hydroxyacetic acid;silane;zirconium
2-hydroxyacetic acid;silane;zirconium (PubChem CID 174940076) has the molecular formula C2H8O3SiZr
and a molecular weight of 199.39 g/mol. Its IUPAC name is 2-hydroxyacetic acid;silane;zirconium.
Molecular Properties
| Compound Name | 2-hydroxyacetic acid;silane;zirconium |
| PubChem CID | 174940076 |
| Molecular Formula | C2H8O3SiZr |
| Molecular Weight | 199.39 g/mol |
| Exact Mass | 197.93 |
| IUPAC Name | 2-hydroxyacetic acid;silane;zirconium |
| SMILES | O=C(O)CO.[SiH4].[Zr] |
| InChI | InChI=1S/C2H4O3.H4Si.Zr/c3-1-2(4)5;;/h3H,1H2,(H,4,5);1H4; |
| InChIKey | MFOGWGCDVWFKAL-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.39 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyacetic acid;silane;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyacetic acid;silane;zirconium?
The IUPAC name of 2-hydroxyacetic acid;silane;zirconium (CID 174940076) is 2-hydroxyacetic acid;silane;zirconium.
What is the SMILES notation for 2-hydroxyacetic acid;silane;zirconium?
The canonical SMILES for 2-hydroxyacetic acid;silane;zirconium is O=C(O)CO.[SiH4].[Zr].
What is the InChIKey of 2-hydroxyacetic acid;silane;zirconium?
The InChIKey is MFOGWGCDVWFKAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O3.H4Si.Zr/c3-1-2(4)5;;/h3H,1H2,(H,4,5);1H4;.
What are the key properties of 2-hydroxyacetic acid;silane;zirconium?
2-hydroxyacetic acid;silane;zirconium has a molecular weight of 199.39 g/mol, XLogP of -2.39, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyacetic acid;silane;zirconium is sourced from PubChem (CID 174940076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).