About 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid
5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid (PubChem CID 158693465) has the molecular formula C21H24ClNO2
and a molecular weight of 357.88 g/mol. Its IUPAC name is 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid |
| PubChem CID | 158693465 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid |
| SMILES | Cc1cc(C)c(C(=O)O)cc1CC1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H24ClNO2/c1-14-11-15(2)18(21(24)25)13-17(14)12-16-7-9-23(10-8-16)20-6-4-3-5-19(20)22/h3-6,11,13,16H,7-10,12H2,1-2H3,(H,24,25) |
| InChIKey | HRSZNWBHBJXHQN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid?
The IUPAC name of 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid (CID 158693465) is 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid.
What is the SMILES notation for 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid?
The canonical SMILES for 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid is Cc1cc(C)c(C(=O)O)cc1CC1CCN(c2ccccc2Cl)CC1.
What is the InChIKey of 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid?
The InChIKey is HRSZNWBHBJXHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24ClNO2/c1-14-11-15(2)18(21(24)25)13-17(14)12-16-7-9-23(10-8-16)20-6-4-3-5-19(20)22/h3-6,11,13,16H,7-10,12H2,1-2H3,(H,24,25).
What are the key properties of 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid?
5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid has a molecular weight of 357.88 g/mol, XLogP of 5.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[1-(2-chlorophenyl)piperidin-4-yl]methyl]-2,4-dimethylbenzoic acid is sourced from PubChem (CID 158693465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).