C21H20N+ — CID 158693695
2-(4,7-dimethyl-9H-fluoren-3-yl)-1-methylpyridin-1-ium (PubChem CID 158693695) has the molecular formula C21H20N+ and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-(4,7-dimethyl-9H-fluoren-3-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(4,7-dimethyl-9H-fluoren-3-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 158693695 |
| Molecular Formula | C21H20N+ |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 2-(4,7-dimethyl-9H-fluoren-3-yl)-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(c1)Cc1ccc(-c3cccc[n+]3C)c(C)c1-2 |
| InChI | InChI=1S/C21H20N/c1-14-7-9-19-17(12-14)13-16-8-10-18(15(2)21(16)19)20-6-4-5-11-22(20)3/h4-12H,13H2,1-3H3/q+1 |
| InChIKey | HGQNVBWGRAWAPZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|