C12H16FN3O2 — CID 158693834
(3S)-3-fluoro-4-methyl-1-(5-methylpyrimidin-2-yl)piperidine-4-carboxylic acid (PubChem CID 158693834) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is (3S)-3-fluoro-4-methyl-1-(5-methylpyrimidin-2-yl)piperidine-4-carboxylic acid.
| Compound Name | (3S)-3-fluoro-4-methyl-1-(5-methylpyrimidin-2-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 158693834 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (3S)-3-fluoro-4-methyl-1-(5-methylpyrimidin-2-yl)piperidine-4-carboxylic acid |
| SMILES | Cc1cnc(N2CCC(C)(C(=O)O)[C@H](F)C2)nc1 |
| InChI | InChI=1S/C12H16FN3O2/c1-8-5-14-11(15-6-8)16-4-3-12(2,10(17)18)9(13)7-16/h5-6,9H,3-4,7H2,1-2H3,(H,17,18)/t9-,12?/m1/s1 |
| InChIKey | IGRMDOZNEGEKNF-PKEIRNPWSA-N |
| XLogP | 1.42 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |