C4H8O2S — CID 15869436
(3S,4R)-thiolane-3,4-diol (PubChem CID 15869436) has the molecular formula C4H8O2S and a molecular weight of 120.17 g/mol. Its IUPAC name is (3S,4R)-thiolane-3,4-diol.
| Compound Name | (3S,4R)-thiolane-3,4-diol |
|---|---|
| PubChem CID | 15869436 |
| Molecular Formula | C4H8O2S |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.02 |
| IUPAC Name | (3S,4R)-thiolane-3,4-diol |
| SMILES | O[C@@H]1CSC[C@@H]1O |
| InChI | InChI=1S/C4H8O2S/c5-3-1-7-2-4(3)6/h3-6H,1-2H2/t3-,4+ |
| InChIKey | WONPWMKTZAPWSP-ZXZARUISSA-N |
| XLogP | -0.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |