C31H26F2N10O2 — CID 158694549
4-(5-fluoro-3-pyridinyl)-2-nitro-6-pyrimidin-2-ylaniline;5-(5-fluoro-3-pyridinyl)-3-pyrimidin-2-ylbenzene-1,2-diamine;methane (PubChem CID 158694549) has the molecular formula C31H26F2N10O2 and a molecular weight of 608.61 g/mol. Its IUPAC name is 4-(5-fluoro-3-pyridinyl)-2-nitro-6-pyrimidin-2-ylaniline;5-(5-fluoro-3-pyridinyl)-3-pyrimidin-2-ylbenzene-1,2-diamine;methane.
| Compound Name | 4-(5-fluoro-3-pyridinyl)-2-nitro-6-pyrimidin-2-ylaniline;5-(5-fluoro-3-pyridinyl)-3-pyrimidin-2-ylbenzene-1,2-diamine;methane |
|---|---|
| PubChem CID | 158694549 |
| Molecular Formula | C31H26F2N10O2 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | 4-(5-fluoro-3-pyridinyl)-2-nitro-6-pyrimidin-2-ylaniline;5-(5-fluoro-3-pyridinyl)-3-pyrimidin-2-ylbenzene-1,2-diamine;methane |
| SMILES | C.Nc1c(-c2ncccn2)cc(-c2cncc(F)c2)cc1[N+](=O)[O-].Nc1cc(-c2cncc(F)c2)cc(-c2ncccn2)c1N |
| InChI | InChI=1S/C15H10FN5O2.C15H12FN5.CH4/c16-11-4-10(7-18-8-11)9-5-12(15-19-2-1-3-20-15)14(17)13(6-9)21(22)23;16-11-4-10(7-19-8-11)9-5-12(14(18)13(17)6-9)15-20-2-1-3-21-15;/h1-8H,17H2;1-8H,17-18H2;1H4 |
| InChIKey | IGTUHSGRPCXTQG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 198.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|