C33H48O8 — CID 158695693
2-[2-[3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoyloxy]ethoxymethoxy]ethyl 3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoate (PubChem CID 158695693) has the molecular formula C33H48O8 and a molecular weight of 572.74 g/mol. Its IUPAC name is 2-[2-[3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoyloxy]ethoxymethoxy]ethyl 3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoate.
| Compound Name | 2-[2-[3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoyloxy]ethoxymethoxy]ethyl 3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoate |
|---|---|
| PubChem CID | 158695693 |
| Molecular Formula | C33H48O8 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | 2-[2-[3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoyloxy]ethoxymethoxy]ethyl 3-(3-tert-butyl-2-hydroxy-5-methylphenyl)propanoate |
| SMILES | Cc1cc(CCC(=O)OCCOCOCCOC(=O)CCc2cc(C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H48O8/c1-22-17-24(30(36)26(19-22)32(3,4)5)9-11-28(34)40-15-13-38-21-39-14-16-41-29(35)12-10-25-18-23(2)20-27(31(25)37)33(6,7)8/h17-20,36-37H,9-16,21H2,1-8H3 |
| InChIKey | IGXKSTKUHLTQFQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|