C19H16 — CID 158698330
1,1'-spirobi[2H-naphthalene] (PubChem CID 158698330) has the molecular formula C19H16 and a molecular weight of 244.34 g/mol. Its IUPAC name is 1,1'-spirobi[2H-naphthalene].
| Compound Name | 1,1'-spirobi[2H-naphthalene] |
|---|---|
| PubChem CID | 158698330 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1,1'-spirobi[2H-naphthalene] |
| SMILES | C1=Cc2ccccc2C2(C1)CC=Cc1ccccc12 |
| InChI | InChI=1S/C19H16/c1-3-11-17-15(7-1)9-5-13-19(17)14-6-10-16-8-2-4-12-18(16)19/h1-12H,13-14H2 |
| InChIKey | XVFONZJWAYXIQX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |