About 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane
3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane (PubChem CID 158698333) has the molecular formula C13H22ClIN2
and a molecular weight of 368.69 g/mol. Its IUPAC name is 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane.
Molecular Properties
| Compound Name | 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane |
| PubChem CID | 158698333 |
| Molecular Formula | C13H22ClIN2 |
| Molecular Weight | 368.69 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane |
| SMILES | C.CI.Cc1ncc([C@@H]2CCCN2C)cc1Cl |
| InChI | InChI=1S/C11H15ClN2.CH3I.CH4/c1-8-10(12)6-9(7-13-8)11-4-3-5-14(11)2;1-2;/h6-7,11H,3-5H2,1-2H3;1H3;1H4/t11-;;/m0../s1 |
| InChIKey | IHFLVIGLCVADIW-IDMXKUIJSA-N |
| XLogP | 4.50 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane?
The IUPAC name of 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane (CID 158698333) is 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane.
What is the SMILES notation for 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane?
The canonical SMILES for 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane is C.CI.Cc1ncc([C@@H]2CCCN2C)cc1Cl.
What is the InChIKey of 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane?
The InChIKey is IHFLVIGLCVADIW-IDMXKUIJSA-N. The full InChI is InChI=1S/C11H15ClN2.CH3I.CH4/c1-8-10(12)6-9(7-13-8)11-4-3-5-14(11)2;1-2;/h6-7,11H,3-5H2,1-2H3;1H3;1H4/t11-;;/m0../s1.
What are the key properties of 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane?
3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane has a molecular weight of 368.69 g/mol, XLogP of 4.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-methyl-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine;iodomethane;methane is sourced from PubChem (CID 158698333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).