C8H7F3N2O2 — CID 158699580
2,2,2-trifluoro-N-(5-methyl-2-oxo-1H-pyridin-3-yl)acetamide (PubChem CID 158699580) has the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(5-methyl-2-oxo-1H-pyridin-3-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(5-methyl-2-oxo-1H-pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 158699580 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2,2,2-trifluoro-N-(5-methyl-2-oxo-1H-pyridin-3-yl)acetamide |
| SMILES | Cc1c[nH]c(=O)c(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C8H7F3N2O2/c1-4-2-5(6(14)12-3-4)13-7(15)8(9,10)11/h2-3H,1H3,(H,12,14)(H,13,15) |
| InChIKey | IHJFIZHJQXVRKK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |