C16H19F2NO5 — CID 158701890
methyl (Z)-3-(2,6-difluoroanilino)but-2-enoate;methyl 3-oxobutanoate (PubChem CID 158701890) has the molecular formula C16H19F2NO5 and a molecular weight of 343.33 g/mol. Its IUPAC name is methyl (Z)-3-(2,6-difluoroanilino)but-2-enoate;methyl 3-oxobutanoate.
| Compound Name | methyl (Z)-3-(2,6-difluoroanilino)but-2-enoate;methyl 3-oxobutanoate |
|---|---|
| PubChem CID | 158701890 |
| Molecular Formula | C16H19F2NO5 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | methyl (Z)-3-(2,6-difluoroanilino)but-2-enoate;methyl 3-oxobutanoate |
| SMILES | COC(=O)/C=C(/C)Nc1c(F)cccc1F.COC(=O)CC(C)=O |
| InChI | InChI=1S/C11H11F2NO2.C5H8O3/c1-7(6-10(15)16-2)14-11-8(12)4-3-5-9(11)13;1-4(6)3-5(7)8-2/h3-6,14H,1-2H3;3H2,1-2H3/b7-6-; |
| InChIKey | IHQJYBSNWABFFR-NAFXZHHSSA-N |
| XLogP | 2.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|