C10H12F3N3O3S — CID 158704843
4-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 158704843) has the molecular formula C10H12F3N3O3S and a molecular weight of 311.29 g/mol. Its IUPAC name is 4-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158704843 |
| Molecular Formula | C10H12F3N3O3S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-methyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1NCCc2nc(C(N)=O)sc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H11N3OS.C2HF3O2/c1-4-6-5(2-3-10-4)11-8(13-6)7(9)12;3-2(4,5)1(6)7/h4,10H,2-3H2,1H3,(H2,9,12);(H,6,7) |
| InChIKey | IHZGSZKJYRQTJG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |