C27H28ClN5O10 — CID 158705415
methyl 2-amino-3-(4-nitrophenyl)propanoate;methyl 3-(4-nitrophenyl)-2-[(4-nitrosobenzoyl)amino]propanoate;hydrochloride (PubChem CID 158705415) has the molecular formula C27H28ClN5O10 and a molecular weight of 618.00 g/mol. Its IUPAC name is methyl 2-amino-3-(4-nitrophenyl)propanoate;methyl 3-(4-nitrophenyl)-2-[(4-nitrosobenzoyl)amino]propanoate;hydrochloride.
| Compound Name | methyl 2-amino-3-(4-nitrophenyl)propanoate;methyl 3-(4-nitrophenyl)-2-[(4-nitrosobenzoyl)amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 158705415 |
| Molecular Formula | C27H28ClN5O10 |
| Molecular Weight | 618.00 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | methyl 2-amino-3-(4-nitrophenyl)propanoate;methyl 3-(4-nitrophenyl)-2-[(4-nitrosobenzoyl)amino]propanoate;hydrochloride |
| SMILES | COC(=O)C(Cc1ccc([N+](=O)[O-])cc1)NC(=O)c1ccc(N=O)cc1.COC(=O)C(N)Cc1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C17H15N3O6.C10H12N2O4.ClH/c1-26-17(22)15(10-11-2-8-14(9-3-11)20(24)25)18-16(21)12-4-6-13(19-23)7-5-12;1-16-10(13)9(11)6-7-2-4-8(5-3-7)12(14)15;/h2-9,15H,10H2,1H3,(H,18,21);2-5,9H,6,11H2,1H3;1H |
| InChIKey | SKBVABMSOGYENX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 223.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.00 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|